* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BM 0321 |
| EnglishSynonyms: | RARECHEM AL BM 0321 |
| pro_mdlNumber: | MFCD06207176 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C/C(=C\c1cc(cc(c1)F)C(F)(F)F)/C(=O)O |
| InChi: | InChI=1S/C11H8F4O2/c1-6(10(16)17)2-7-3-8(11(13,14)15)5-9(12)4-7/h2-5H,1H3,(H,16,17)/b6-2+ |
| InChiKey: | InChIKey=LTUBLEQRIGMQEY-QHHAFSJGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.