* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BM 1102 |
| EnglishSynonyms: | RARECHEM AL BM 1102 |
| pro_mdlNumber: | MFCD06207696 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1CCN(CC1)c2ccccc2/C=C(\C)/C(=O)O |
| InChi: | InChI=1S/C18H23NO4/c1-3-23-18(22)14-8-10-19(11-9-14)16-7-5-4-6-15(16)12-13(2)17(20)21/h4-7,12,14H,3,8-11H2,1-2H3,(H,20,21)/b13-12+ |
| InChiKey: | InChIKey=UQDFFEUKXYHCLJ-OUKQBFOZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.