* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BM 1129 |
EnglishSynonyms: | RARECHEM AL BM 1129 |
pro_mdlNumber: | MFCD06207715 |
pro_acceptors: | 5 |
pro_donors: | 3 |
pro_smile: | C/C(=C\c1c[nH]c2c1cccc2C(=O)O)/C(=O)O |
InChi: | InChI=1S/C13H11NO4/c1-7(12(15)16)5-8-6-14-11-9(8)3-2-4-10(11)13(17)18/h2-6,14H,1H3,(H,15,16)(H,17,18)/b7-5+ |
InChiKey: | InChIKey=GUAGZBWBJATOKG-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.