* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BM 1176 |
| EnglishSynonyms: | RARECHEM AL BM 1176 |
| pro_mdlNumber: | MFCD06207754 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCCCCc1ccc(cc1)C(=O)c2cc3cc(ccc3o2)/C=C(\C)/C(=O)O |
| InChi: | InChI=1S/C24H24O4/c1-3-4-5-6-17-7-10-19(11-8-17)23(25)22-15-20-14-18(9-12-21(20)28-22)13-16(2)24(26)27/h7-15H,3-6H2,1-2H3,(H,26,27)/b16-13+ |
| InChiKey: | InChIKey=BNSBSJHQCKKQPJ-DTQAZKPQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.