* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BM 1262 |
| EnglishSynonyms: | RARECHEM AL BM 1262 |
| pro_mdlNumber: | MFCD06207825 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | C/C(=C\c1cncn1Cc2ccccc2)/C(=O)O |
| InChi: | InChI=1S/C14H14N2O2/c1-11(14(17)18)7-13-8-15-10-16(13)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,17,18)/b11-7+ |
| InChiKey: | InChIKey=QDFLOVJKKYTUIP-YRNVUSSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.