* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1422 |
| EnglishSynonyms: | RARECHEM AL BO 1422 |
| pro_mdlNumber: | MFCD06208397 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C(C[Zn]Br)C(=O)O |
| InChi: | InChI=1S/C3H5O2.BrH.Zn/c1-2-3(4)5;;/h1-2H2,(H,4,5);1H;/q;;+1/p-1 |
| InChiKey: | InChIKey=KKRACDGSHJRUNC-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.