* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1425 |
| EnglishSynonyms: | RARECHEM AL BO 1425 |
| pro_mdlNumber: | MFCD06208400 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1cc(ccc1C(=O)O)[Zn]Br |
| InChi: | InChI=1S/C7H5O2.BrH.Zn/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1 |
| InChiKey: | InChIKey=KTYGIEIRYMHVGO-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.