* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1431 |
| EnglishSynonyms: | RARECHEM AL BO 1431 |
| pro_mdlNumber: | MFCD06208405 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(c(c1)C[Zn][BrH](=O)O)C(=O)O |
| InChi: | InChI=1S/C8H7O2.BrH2O2.Zn/c1-6-4-2-3-5-7(6)8(9)10;2-1-3;/h2-5H,1H2,(H,9,10);1H,(H,2,3); |
| InChiKey: | InChIKey=BFFNQBJGJZIYRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.