* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1432 |
| EnglishSynonyms: | RARECHEM AL BO 1432 |
| pro_mdlNumber: | MFCD06208406 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1cc(cc(c1)C(=O)O)C[Zn]Br |
| InChi: | InChI=1S/C8H7O2.BrH.Zn/c1-6-3-2-4-7(5-6)8(9)10;;/h2-5H,1H2,(H,9,10);1H;/q;;+1/p-1 |
| InChiKey: | InChIKey=RPLDBNIUBSKMRH-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.