* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1436 |
| EnglishSynonyms: | RARECHEM AL BO 1436 |
| pro_mdlNumber: | MFCD06208410 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C(CC[Zn]Br)CC(=O)O |
| InChi: | InChI=1S/C5H9O2.BrH.Zn/c1-2-3-4-5(6)7;;/h1-4H2,(H,6,7);1H;/q;;+1/p-1 |
| InChiKey: | InChIKey=INFUPOKJQPKRLW-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.