* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BO 1475 |
EnglishSynonyms: | RARECHEM AL BO 1475 |
pro_mdlNumber: | MFCD06208417 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | CCCCCCOc1cc(c(cc1CC(=O)O)OCCCCCC)CC(=O)O |
InChi: | InChI=1S/C22H34O6/c1-3-5-7-9-11-27-19-13-18(16-22(25)26)20(14-17(19)15-21(23)24)28-12-10-8-6-4-2/h13-14H,3-12,15-16H2,1-2H3,(H,23,24)(H,25,26) |
InChiKey: | InChIKey=MCKZYZPLKSLCJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.