* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1484 |
| EnglishSynonyms: | RARECHEM AL BO 1484 |
| pro_mdlNumber: | MFCD06208420 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc2c(cc1CCC(=O)O)NC(=O)CN2 |
| InChi: | InChI=1S/C11H12N2O3/c14-10-6-12-8-3-1-7(2-4-11(15)16)5-9(8)13-10/h1,3,5,12H,2,4,6H2,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=ZFEZQLDALQFPOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.