* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BO 1488 |
EnglishSynonyms: | RARECHEM AL BO 1488 |
pro_mdlNumber: | MFCD06208421 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | c1c(c(nc(n1)N2CCCCC2)N)C(=O)O |
InChi: | InChI=1S/C10H14N4O2/c11-8-7(9(15)16)6-12-10(13-8)14-4-2-1-3-5-14/h6H,1-5H2,(H,15,16)(H2,11,12,13) |
InChiKey: | InChIKey=ABRRUXAEQQAIJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.