* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1576 |
| EnglishSynonyms: | RARECHEM AL BO 1576 |
| pro_mdlNumber: | MFCD06208455 |
| pro_acceptors: | 6 |
| pro_donors: | 4 |
| pro_smile: | CC(=O)C(C(=N)NN)C(=O)O |
| InChi: | InChI=1S/C5H9N3O3/c1-2(9)3(5(10)11)4(6)8-7/h3H,7H2,1H3,(H2,6,8)(H,10,11) |
| InChiKey: | InChIKey=HTYINRVXXRMTNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.