* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1586 |
| EnglishSynonyms: | RARECHEM AL BO 1586 |
| pro_mdlNumber: | MFCD06208461 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(=O)C(C(=S)N)C(=O)O |
| InChi: | InChI=1S/C5H7NO3S/c1-2(7)3(4(6)10)5(8)9/h3H,1H3,(H2,6,10)(H,8,9) |
| InChiKey: | InChIKey=ZHGYYRJNOXFLNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.