* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1611 |
| EnglishSynonyms: | RARECHEM AL BO 1611 |
| pro_mdlNumber: | MFCD06208478 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | Cc1c(cco1)C(=O)CC(=O)O |
| InChi: | InChI=1S/C8H8O4/c1-5-6(2-3-12-5)7(9)4-8(10)11/h2-3H,4H2,1H3,(H,10,11) |
| InChiKey: | InChIKey=OSFBZBDSBCAACQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.