* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1749 |
| EnglishSynonyms: | RARECHEM AL BO 1749 |
| pro_mdlNumber: | MFCD06208555 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)CS/C(=C(/C(=O)N)\C(=O)O)/S |
| InChi: | InChI=1S/C11H11NO3S2/c12-9(13)8(10(14)15)11(16)17-6-7-4-2-1-3-5-7/h1-5,16H,6H2,(H2,12,13)(H,14,15)/b11-8- |
| InChiKey: | InChIKey=RWCBBSDQIQHDBI-FLIBITNWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.