* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1751 |
| EnglishSynonyms: | RARECHEM AL BO 1751 |
| pro_mdlNumber: | MFCD06208557 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | c1cc(n(c1)CCC(=O)O)C(=O)C(=O)Nc2ccc(cc2)F |
| InChi: | InChI=1S/C15H13FN2O4/c16-10-3-5-11(6-4-10)17-15(22)14(21)12-2-1-8-18(12)9-7-13(19)20/h1-6,8H,7,9H2,(H,17,22)(H,19,20) |
| InChiKey: | InChIKey=HUIRGXQEUWWRGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.