* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1782 |
| EnglishSynonyms: | RARECHEM AL BO 1782 |
| pro_mdlNumber: | MFCD06208575 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | Cc1cc(c(c(=O)n1N)C(=O)O)C(F)(F)F |
| InChi: | InChI=1S/C8H7F3N2O3/c1-3-2-4(8(9,10)11)5(7(15)16)6(14)13(3)12/h2H,12H2,1H3,(H,15,16) |
| InChiKey: | InChIKey=DSCXMZCLPAFFMZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.