* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BO 1818 |
EnglishSynonyms: | RARECHEM AL BO 1818 |
pro_mdlNumber: | MFCD06208598 |
pro_acceptors: | 7 |
pro_donors: | 2 |
pro_smile: | Cc1cc(nc(n1)N/C=C(/C(=O)c2cccc(c2)OC)\C(=O)O)Cl |
InChi: | InChI=1S/C16H14ClN3O4/c1-9-6-13(17)20-16(19-9)18-8-12(15(22)23)14(21)10-4-3-5-11(7-10)24-2/h3-8H,1-2H3,(H,22,23)(H,18,19,20)/b12-8- |
InChiKey: | InChIKey=BGYOOPJNBJSLOW-WQLSENKSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.