* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1832 |
| EnglishSynonyms: | RARECHEM AL BO 1832 |
| pro_mdlNumber: | MFCD06208609 |
| pro_acceptors: | 6 |
| pro_donors: | 4 |
| pro_smile: | c1ccc(cc1)CNC(=O)/C(=C\c2ccc(c(c2)O)O)/C(=O)O |
| InChi: | InChI=1S/C17H15NO5/c19-14-7-6-12(9-15(14)20)8-13(17(22)23)16(21)18-10-11-4-2-1-3-5-11/h1-9,19-20H,10H2,(H,18,21)(H,22,23)/b13-8+ |
| InChiKey: | InChIKey=WXJNWGNDKQYPHI-MDWZMJQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.