* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1932 |
| EnglishSynonyms: | RARECHEM AL BO 1932 |
| pro_mdlNumber: | MFCD06208674 |
| pro_acceptors: | 9 |
| pro_donors: | 3 |
| pro_smile: | Cc1c2c([nH]n1)OC(=C(C2c3cccc(c3)[N+](=O)[O-])C(=O)O)N |
| InChi: | InChI=1S/C14H12N4O5/c1-6-9-10(7-3-2-4-8(5-7)18(21)22)11(14(19)20)12(15)23-13(9)17-16-6/h2-5,10H,15H2,1H3,(H,16,17)(H,19,20) |
| InChiKey: | InChIKey=ZCFHCWKGVULOBM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.