* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BO 1933 |
| EnglishSynonyms: | RARECHEM AL BO 1933 |
| pro_mdlNumber: | MFCD06208675 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | CC(C)(C)C(=O)/C(=C\NCCc1c[nH]c2c1cccc2)/C(=O)O |
| InChi: | InChI=1S/C18H22N2O3/c1-18(2,3)16(21)14(17(22)23)11-19-9-8-12-10-20-15-7-5-4-6-13(12)15/h4-7,10-11,19-20H,8-9H2,1-3H3,(H,22,23)/b14-11+ |
| InChiKey: | InChIKey=HDCXPBBXCYLSHN-SDNWHVSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.