* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0248 |
| EnglishSynonyms: | RARECHEM AL BP 0248 |
| pro_mdlNumber: | MFCD06209094 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | CCOc1ccc(cc1C2OCCO2)Br |
| InChi: | InChI=1S/C11H13BrO3/c1-2-13-10-4-3-8(12)7-9(10)11-14-5-6-15-11/h3-4,7,11H,2,5-6H2,1H3 |
| InChiKey: | InChIKey=SKMBXPGGQIPDMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.