* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0251 |
| EnglishSynonyms: | RARECHEM AL BP 0251 |
| pro_mdlNumber: | MFCD06209097 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CCOc1ccc(cc1OCC)C2OCCO2 |
| InChi: | InChI=1S/C13H18O4/c1-3-14-11-6-5-10(9-12(11)15-4-2)13-16-7-8-17-13/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChiKey: | InChIKey=TZIBUUOKOANKLP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.