* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 0293 |
EnglishSynonyms: | RARECHEM AL BP 0293 |
pro_mdlNumber: | MFCD06209135 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | Cc1c2ccccc2sc1C3OCCO3 |
InChi: | InChI=1S/C12H12O2S/c1-8-9-4-2-3-5-10(9)15-11(8)12-13-6-7-14-12/h2-5,12H,6-7H2,1H3 |
InChiKey: | InChIKey=BSTOMIMBOYNZMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.