* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0294 |
| EnglishSynonyms: | RARECHEM AL BP 0294 |
| pro_mdlNumber: | MFCD06209136 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | CC(C)Oc1ccc(cc1)C2OCCO2 |
| InChi: | InChI=1S/C12H16O3/c1-9(2)15-11-5-3-10(4-6-11)12-13-7-8-14-12/h3-6,9,12H,7-8H2,1-2H3 |
| InChiKey: | InChIKey=JIVTXOYGDVHNBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.