* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0405 |
| EnglishSynonyms: | RARECHEM AL BP 0405 |
| pro_mdlNumber: | MFCD06209231 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | Cc1c([nH]cn1)C2OCCO2 |
| InChi: | InChI=1S/C7H10N2O2/c1-5-6(9-4-8-5)7-10-2-3-11-7/h4,7H,2-3H2,1H3,(H,8,9) |
| InChiKey: | InChIKey=CWCBTYXRYWFFMZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.