* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0413 |
| EnglishSynonyms: | RARECHEM AL BP 0413 |
| pro_mdlNumber: | MFCD06209238 |
| pro_acceptors: | 11 |
| pro_donors: | 7 |
| pro_smile: | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@H]([C@H]([C@@H]([C@H](C2OCCO2)O)O)O)O)O)O)O |
| InChi: | InChI=1S/C14H26O11/c1-5-7(16)9(18)12(21)14(25-5)24-4-6(15)8(17)10(19)11(20)13-22-2-3-23-13/h5-21H,2-4H2,1H3/t5-,6+,7-,8+,9+,10-,11+,12+,14+/m0/s1 |
| InChiKey: | InChIKey=HWTQKARJEWQSTN-MIWMIVENSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.