* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0415 |
| EnglishSynonyms: | RARECHEM AL BP 0415 |
| pro_mdlNumber: | MFCD06209239 |
| pro_acceptors: | 6 |
| pro_donors: | 4 |
| pro_smile: | C1COC(O1)[C@H]([C@H]([C@H](CO)O)O)O |
| InChi: | InChI=1S/C7H14O6/c8-3-4(9)5(10)6(11)7-12-1-2-13-7/h4-11H,1-3H2/t4-,5-,6-/m0/s1 |
| InChiKey: | InChIKey=WBADVFOGHTVPTF-ZLUOBGJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.