* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0420 |
| EnglishSynonyms: | RARECHEM AL BP 0420 |
| pro_mdlNumber: | MFCD06209242 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C1COC(O1)CC(C(C(F)(F)F)(F)F)(C(F)(F)F)F |
| InChi: | InChI=1S/C8H7F9O2/c9-5(7(12,13)14,3-4-18-1-2-19-4)6(10,11)8(15,16)17/h4H,1-3H2 |
| InChiKey: | InChIKey=SWCXUQAZNHNRHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.