* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0422 |
| EnglishSynonyms: | RARECHEM AL BP 0422 |
| pro_mdlNumber: | MFCD06209244 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | C1COC(O1)CC(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F |
| InChi: | InChI=1S/C9H7F11O3/c10-5(7(13,14)15,3-4-21-1-2-22-4)23-9(19,20)6(11,12)8(16,17)18/h4H,1-3H2 |
| InChiKey: | InChIKey=SEBLHSFOQWMUIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.