* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 0426 |
| EnglishSynonyms: | RARECHEM AL BP 0426 |
| pro_mdlNumber: | MFCD06209248 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C1COC(O1)CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChi: | InChI=1S/C10H7F13O2/c11-5(12,3-4-24-1-2-25-4)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h4H,1-3H2 |
| InChiKey: | InChIKey=HEYUOCGAUBAMKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.