* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 0469 |
EnglishSynonyms: | RARECHEM AL BP 0469 |
pro_mdlNumber: | MFCD06209286 |
pro_acceptors: | 5 |
pro_donors: | 0 |
pro_smile: | c1cc(oc1C2OCCO2)C3OCCO3 |
InChi: | InChI=1S/C10H12O5/c1-2-8(10-13-5-6-14-10)15-7(1)9-11-3-4-12-9/h1-2,9-10H,3-6H2 |
InChiKey: | InChIKey=DHVRMYRVYSJOCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.