* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1102 |
EnglishSynonyms: | RARECHEM AL BP 1102 |
pro_mdlNumber: | MFCD06209821 |
pro_acceptors: | 5 |
pro_donors: | 0 |
pro_smile: | CCOC(=O)C1CCN(CC1)c2ccccc2C3OCCO3 |
InChi: | InChI=1S/C17H23NO4/c1-2-20-16(19)13-7-9-18(10-8-13)15-6-4-3-5-14(15)17-21-11-12-22-17/h3-6,13,17H,2,7-12H2,1H3 |
InChiKey: | InChIKey=KNHZLIPCNKHUSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.