* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1131 |
EnglishSynonyms: | RARECHEM AL BP 1131 |
pro_mdlNumber: | MFCD06209847 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | Cc1c(c2ccccc2n1C)C3OCCO3 |
InChi: | InChI=1S/C13H15NO2/c1-9-12(13-15-7-8-16-13)10-5-3-4-6-11(10)14(9)2/h3-6,13H,7-8H2,1-2H3 |
InChiKey: | InChIKey=KJPBKHGWYQNJCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.