* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 1168 |
| EnglishSynonyms: | RARECHEM AL BP 1168 |
| pro_mdlNumber: | MFCD06209883 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | c1cc2c(cc1[N+](=O)[O-])c(c[nH]2)C3OCCO3 |
| InChi: | InChI=1S/C11H10N2O4/c14-13(15)7-1-2-10-8(5-7)9(6-12-10)11-16-3-4-17-11/h1-2,5-6,11-12H,3-4H2 |
| InChiKey: | InChIKey=RRECVWRVHLGWKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.