* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 1223 |
| EnglishSynonyms: | RARECHEM AL BP 1223 |
| pro_mdlNumber: | MFCD06209934 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | c1cc(n(c1)c2c(cc(cc2Cl)Cl)C(F)(F)F)C3OCCO3 |
| InChi: | InChI=1S/C14H10Cl2F3NO2/c15-8-6-9(14(17,18)19)12(10(16)7-8)20-3-1-2-11(20)13-21-4-5-22-13/h1-3,6-7,13H,4-5H2 |
| InChiKey: | InChIKey=CLBIFEAQICEBKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.