* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1250 |
EnglishSynonyms: | RARECHEM AL BP 1250 |
pro_mdlNumber: | MFCD06209960 |
pro_acceptors: | 4 |
pro_donors: | 0 |
pro_smile: | c1cc(ccc1C(C2OCCO2)C3OCCO3)Br |
InChi: | InChI=1S/C13H15BrO4/c14-10-3-1-9(2-4-10)11(12-15-5-6-16-12)13-17-7-8-18-13/h1-4,11-13H,5-8H2 |
InChiKey: | InChIKey=PIOPBQWISAUKFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.