* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BP 1260 |
EnglishSynonyms: | RARECHEM AL BP 1260 |
pro_mdlNumber: | MFCD06209968 |
pro_acceptors: | 4 |
pro_donors: | 0 |
pro_smile: | CC(C)(C)c1cc(n(n1)c2ccc(cc2)C3OCCO3)C(C)(C)C |
InChi: | InChI=1S/C20H28N2O2/c1-19(2,3)16-13-17(20(4,5)6)22(21-16)15-9-7-14(8-10-15)18-23-11-12-24-18/h7-10,13,18H,11-12H2,1-6H3 |
InChiKey: | InChIKey=FQGAHSGBJKRYSN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.