* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BP 1434 |
| EnglishSynonyms: | RARECHEM AL BP 1434 |
| pro_mdlNumber: | MFCD06210127 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | c1c(cc(c(c1C2OCCO2)O)OC(F)(F)F)Br |
| InChi: | InChI=1S/C10H8BrF3O4/c11-5-3-6(9-16-1-2-17-9)8(15)7(4-5)18-10(12,13)14/h3-4,9,15H,1-2H2 |
| InChiKey: | InChIKey=MEXSJTAARXFUKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.