* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0311 |
| EnglishSynonyms: | RARECHEM AL BT 0311 |
| pro_mdlNumber: | MFCD06211976 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)C(CCO)N.Cl |
| InChi: | InChI=1S/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H |
| InChiKey: | InChIKey=VPSAJDGAYRBFPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.