* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0313 |
| EnglishSynonyms: | RARECHEM AL BT 0313 |
| pro_mdlNumber: | MFCD06211978 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | Cc1cc(c(cc1OC)C)C(CCO)N.Cl |
| InChi: | InChI=1S/C12H19NO2.ClH/c1-8-7-12(15-3)9(2)6-10(8)11(13)4-5-14;/h6-7,11,14H,4-5,13H2,1-3H3;1H |
| InChiKey: | InChIKey=KMBOZLUKRLJJIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.