* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0330 |
| EnglishSynonyms: | RARECHEM AL BT 0330 |
| pro_mdlNumber: | MFCD06211994 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CCCCCCCCCCCCOc1ccc(cc1)C(CCO)N.Cl |
| InChi: | InChI=1S/C21H37NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-18-24-20-14-12-19(13-15-20)21(22)16-17-23;/h12-15,21,23H,2-11,16-18,22H2,1H3;1H |
| InChiKey: | InChIKey=XCZGUZQAJUQOFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.