* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0415 |
| EnglishSynonyms: | RARECHEM AL BT 0415 |
| pro_mdlNumber: | MFCD06212074 |
| pro_acceptors: | 3 |
| pro_donors: | 3 |
| pro_smile: | Cc1ccc(c(c1)C(CCO)N)O.Cl |
| InChi: | InChI=1S/C10H15NO2.ClH/c1-7-2-3-10(13)8(6-7)9(11)4-5-12;/h2-3,6,9,12-13H,4-5,11H2,1H3;1H |
| InChiKey: | InChIKey=OGSDVKWDVDQSGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.