* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0437 |
| EnglishSynonyms: | RARECHEM AL BT 0437 |
| pro_mdlNumber: | MFCD06212094 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1cc(ccc1COc2ccc(cc2)C(CCO)N)Br.Cl |
| InChi: | InChI=1S/C16H18BrNO2.ClH/c17-14-5-1-12(2-6-14)11-20-15-7-3-13(4-8-15)16(18)9-10-19;/h1-8,16,19H,9-11,18H2;1H |
| InChiKey: | InChIKey=VKQGHKYVGASNMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.