* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BT 0443 |
EnglishSynonyms: | RARECHEM AL BT 0443 |
pro_mdlNumber: | MFCD06212100 |
pro_acceptors: | 2 |
pro_donors: | 2 |
pro_smile: | C=Cc1cccc(c1)C(CCO)N.Cl |
InChi: | InChI=1S/C11H15NO.ClH/c1-2-9-4-3-5-10(8-9)11(12)6-7-13;/h2-5,8,11,13H,1,6-7,12H2;1H |
InChiKey: | InChIKey=IRTOAKDNYVSWTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.