* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BT 0449 |
EnglishSynonyms: | RARECHEM AL BT 0449 |
pro_mdlNumber: | MFCD06212106 |
pro_acceptors: | 4 |
pro_donors: | 3 |
pro_smile: | COc1cc(cc(c1O)F)C(CCO)N.Cl |
InChi: | InChI=1S/C10H14FNO3.ClH/c1-15-9-5-6(8(12)2-3-13)4-7(11)10(9)14;/h4-5,8,13-14H,2-3,12H2,1H3;1H |
InChiKey: | InChIKey=VVIUSYFZNSLDLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.