* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | RARECHEM AL BT 0463 |
EnglishSynonyms: | RARECHEM AL BT 0463 |
pro_mdlNumber: | MFCD06212120 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | c1cc(cc(c1)OCc2c(cccc2Cl)F)C(CCO)N.Cl |
InChi: | InChI=1S/C16H17ClFNO2.ClH/c17-14-5-2-6-15(18)13(14)10-21-12-4-1-3-11(9-12)16(19)7-8-20;/h1-6,9,16,20H,7-8,10,19H2;1H |
InChiKey: | InChIKey=SLJFPQVOYNDOKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.