* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | RARECHEM AL BT 0469 |
EnglishSynonyms: | RARECHEM AL BT 0469 |
pro_mdlNumber: | MFCD06212125 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | CN(C)c1ccc(c(c1)Cl)C(CCO)N.Cl |
InChi: | InChI=1S/C11H17ClN2O.ClH/c1-14(2)8-3-4-9(10(12)7-8)11(13)5-6-15;/h3-4,7,11,15H,5-6,13H2,1-2H3;1H |
InChiKey: | InChIKey=SWUOONJEOYDQMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.